C17H26N2O5S — CID 119192606
2-[[4-(butan-2-ylsulfamoyl)benzoyl]-(2-methylpropyl)amino]acetic acid (PubChem CID 119192606) has the molecular formula C17H26N2O5S and a molecular weight of 370.47 g/mol. Its IUPAC name is 2-[[4-(butan-2-ylsulfamoyl)benzoyl]-(2-methylpropyl)amino]acetic acid.
| Compound Name | 2-[[4-(butan-2-ylsulfamoyl)benzoyl]-(2-methylpropyl)amino]acetic acid |
|---|---|
| PubChem CID | 119192606 |
| Molecular Formula | C17H26N2O5S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 2-[[4-(butan-2-ylsulfamoyl)benzoyl]-(2-methylpropyl)amino]acetic acid |
| SMILES | CCC(C)NS(=O)(=O)c1ccc(C(=O)N(CC(=O)O)CC(C)C)cc1 |
| InChI | InChI=1S/C17H26N2O5S/c1-5-13(4)18-25(23,24)15-8-6-14(7-9-15)17(22)19(10-12(2)3)11-16(20)21/h6-9,12-13,18H,5,10-11H2,1-4H3,(H,20,21) |
| InChIKey | VHWUAEGBWJWIKF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |