C16H20ClNO4 — CID 119193619
2-[(4-chlorophenyl)methyl-(4-prop-2-enoxybutanoyl)amino]acetic acid (PubChem CID 119193619) has the molecular formula C16H20ClNO4 and a molecular weight of 325.79 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl-(4-prop-2-enoxybutanoyl)amino]acetic acid.
| Compound Name | 2-[(4-chlorophenyl)methyl-(4-prop-2-enoxybutanoyl)amino]acetic acid |
|---|---|
| PubChem CID | 119193619 |
| Molecular Formula | C16H20ClNO4 |
| Molecular Weight | 325.79 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl-(4-prop-2-enoxybutanoyl)amino]acetic acid |
| SMILES | C=CCOCCCC(=O)N(CC(=O)O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H20ClNO4/c1-2-9-22-10-3-4-15(19)18(12-16(20)21)11-13-5-7-14(17)8-6-13/h2,5-8H,1,3-4,9-12H2,(H,20,21) |
| InChIKey | XROXFIGIQRGODO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.79 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|