C14H19N5O3 — CID 119193998
(2S,3S)-2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbonyl)amino]-3-methylpentanoic acid (PubChem CID 119193998) has the molecular formula C14H19N5O3 and a molecular weight of 305.34 g/mol. Its IUPAC name is (2S,3S)-2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbonyl)amino]-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbonyl)amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 119193998 |
| Molecular Formula | C14H19N5O3 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | (2S,3S)-2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbonyl)amino]-3-methylpentanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)c1nc2nc(C)cc(C)n2n1)C(=O)O |
| InChI | InChI=1S/C14H19N5O3/c1-5-7(2)10(13(21)22)16-12(20)11-17-14-15-8(3)6-9(4)19(14)18-11/h6-7,10H,5H2,1-4H3,(H,16,20)(H,21,22)/t7-,10-/m0/s1 |
| InChIKey | WJORZIYYYVATBH-XVKPBYJWSA-N |
| XLogP | 0.97 |
| TPSA | 109.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |