C21H22N2O4 — CID 119196199
2-(4-benzamidobutanoyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (PubChem CID 119196199) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is 2-(4-benzamidobutanoyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid.
| Compound Name | 2-(4-benzamidobutanoyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 119196199 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 2-(4-benzamidobutanoyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| SMILES | O=C(NCCCC(=O)N1Cc2ccccc2CC1C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C21H22N2O4/c24-19(11-6-12-22-20(25)15-7-2-1-3-8-15)23-14-17-10-5-4-9-16(17)13-18(23)21(26)27/h1-5,7-10,18H,6,11-14H2,(H,22,25)(H,26,27) |
| InChIKey | WYFZBXBOMNGKRP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|