C19H26ClN5OS — CID 11919628
(2R)-2-[[4-amino-5-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]propanamide (PubChem CID 11919628) has the molecular formula C19H26ClN5OS and a molecular weight of 407.97 g/mol. Its IUPAC name is (2R)-2-[[4-amino-5-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]propanamide.
| Compound Name | (2R)-2-[[4-amino-5-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]propanamide |
|---|---|
| PubChem CID | 11919628 |
| Molecular Formula | C19H26ClN5OS |
| Molecular Weight | 407.97 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | (2R)-2-[[4-amino-5-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]propanamide |
| SMILES | C[C@H]1[C@@H](NC(=O)[C@@H](C)Sc2nnc(-c3cccc(Cl)c3)n2N)CCC[C@@H]1C |
| InChI | InChI=1S/C19H26ClN5OS/c1-11-6-4-9-16(12(11)2)22-18(26)13(3)27-19-24-23-17(25(19)21)14-7-5-8-15(20)10-14/h5,7-8,10-13,16H,4,6,9,21H2,1-3H3,(H,22,26)/t11-,12+,13+,16-/m0/s1 |
| InChIKey | GNNNLPBQTNICBS-VLXAULBPSA-N |
| XLogP | 3.73 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.97 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |