About 2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoyl-propan-2-ylamino]acetic acid
2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoyl-propan-2-ylamino]acetic acid (PubChem CID 119198107) has the molecular formula C16H19N3O5
and a molecular weight of 333.34 g/mol. Its IUPAC name is 2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoyl-propan-2-ylamino]acetic acid.
Molecular Properties
| Compound Name | 2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoyl-propan-2-ylamino]acetic acid |
| PubChem CID | 119198107 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoyl-propan-2-ylamino]acetic acid |
| SMILES | CC(C)N(CC(=O)O)C(=O)CCn1[nH]c(=O)c2ccccc2c1=O |
| InChI | InChI=1S/C16H19N3O5/c1-10(2)18(9-14(21)22)13(20)7-8-19-16(24)12-6-4-3-5-11(12)15(23)17-19/h3-6,10H,7-9H2,1-2H3,(H,17,23)(H,21,22) |
| InChIKey | AXWXIYNPCDYHKA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoyl-propan-2-ylamino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoyl-propan-2-ylamino]acetic acid?
The IUPAC name of 2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoyl-propan-2-ylamino]acetic acid (CID 119198107) is 2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoyl-propan-2-ylamino]acetic acid.
What is the SMILES notation for 2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoyl-propan-2-ylamino]acetic acid?
The canonical SMILES for 2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoyl-propan-2-ylamino]acetic acid is CC(C)N(CC(=O)O)C(=O)CCn1[nH]c(=O)c2ccccc2c1=O.
What is the InChIKey of 2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoyl-propan-2-ylamino]acetic acid?
The InChIKey is AXWXIYNPCDYHKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O5/c1-10(2)18(9-14(21)22)13(20)7-8-19-16(24)12-6-4-3-5-11(12)15(23)17-19/h3-6,10H,7-9H2,1-2H3,(H,17,23)(H,21,22).
What are the key properties of 2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoyl-propan-2-ylamino]acetic acid?
2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoyl-propan-2-ylamino]acetic acid has a molecular weight of 333.34 g/mol, XLogP of 0.40, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoyl-propan-2-ylamino]acetic acid is sourced from PubChem (CID 119198107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).