C13H18N2O5 — CID 119199037
2-[2-(furan-3-carbonylamino)propanoylamino]-2-methylbutanoic acid (PubChem CID 119199037) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-[2-(furan-3-carbonylamino)propanoylamino]-2-methylbutanoic acid.
| Compound Name | 2-[2-(furan-3-carbonylamino)propanoylamino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 119199037 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-[2-(furan-3-carbonylamino)propanoylamino]-2-methylbutanoic acid |
| SMILES | CCC(C)(NC(=O)C(C)NC(=O)c1ccoc1)C(=O)O |
| InChI | InChI=1S/C13H18N2O5/c1-4-13(3,12(18)19)15-10(16)8(2)14-11(17)9-5-6-20-7-9/h5-8H,4H2,1-3H3,(H,14,17)(H,15,16)(H,18,19) |
| InChIKey | WRNNIYKYJKDCMV-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |