About 2-methyl-2-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]butanoic acid
2-methyl-2-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]butanoic acid (PubChem CID 119199666) has the molecular formula C17H22N2O4
and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-methyl-2-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]butanoic acid.
Molecular Properties
| Compound Name | 2-methyl-2-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]butanoic acid |
| PubChem CID | 119199666 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 2-methyl-2-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]butanoic acid |
| SMILES | CCC(C)(NC(=O)CCC1Cc2ccccc2NC1=O)C(=O)O |
| InChI | InChI=1S/C17H22N2O4/c1-3-17(2,16(22)23)19-14(20)9-8-12-10-11-6-4-5-7-13(11)18-15(12)21/h4-7,12H,3,8-10H2,1-2H3,(H,18,21)(H,19,20)(H,22,23) |
| InChIKey | QERRYWWYNWMPDN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-2-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]butanoic acid?
The IUPAC name of 2-methyl-2-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]butanoic acid (CID 119199666) is 2-methyl-2-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]butanoic acid.
What is the SMILES notation for 2-methyl-2-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]butanoic acid?
The canonical SMILES for 2-methyl-2-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]butanoic acid is CCC(C)(NC(=O)CCC1Cc2ccccc2NC1=O)C(=O)O.
What is the InChIKey of 2-methyl-2-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]butanoic acid?
The InChIKey is QERRYWWYNWMPDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O4/c1-3-17(2,16(22)23)19-14(20)9-8-12-10-11-6-4-5-7-13(11)18-15(12)21/h4-7,12H,3,8-10H2,1-2H3,(H,18,21)(H,19,20)(H,22,23).
What are the key properties of 2-methyl-2-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]butanoic acid?
2-methyl-2-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]butanoic acid has a molecular weight of 318.37 g/mol, XLogP of 1.95, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoylamino]butanoic acid is sourced from PubChem (CID 119199666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).