C16H27N3O4 — CID 119199669
2-methyl-2-[[1-(pyrrolidine-1-carbonyl)piperidine-4-carbonyl]amino]butanoic acid (PubChem CID 119199669) has the molecular formula C16H27N3O4 and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-methyl-2-[[1-(pyrrolidine-1-carbonyl)piperidine-4-carbonyl]amino]butanoic acid.
| Compound Name | 2-methyl-2-[[1-(pyrrolidine-1-carbonyl)piperidine-4-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119199669 |
| Molecular Formula | C16H27N3O4 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 2-methyl-2-[[1-(pyrrolidine-1-carbonyl)piperidine-4-carbonyl]amino]butanoic acid |
| SMILES | CCC(C)(NC(=O)C1CCN(C(=O)N2CCCC2)CC1)C(=O)O |
| InChI | InChI=1S/C16H27N3O4/c1-3-16(2,14(21)22)17-13(20)12-6-10-19(11-7-12)15(23)18-8-4-5-9-18/h12H,3-11H2,1-2H3,(H,17,20)(H,21,22) |
| InChIKey | PHJGNYNEQNJQCV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |