C18H25NO6 — CID 119199926
2-[4-(4-acetyl-2-methoxyphenoxy)butanoyl-methylamino]-2-methylpropanoic acid (PubChem CID 119199926) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is 2-[4-(4-acetyl-2-methoxyphenoxy)butanoyl-methylamino]-2-methylpropanoic acid.
| Compound Name | 2-[4-(4-acetyl-2-methoxyphenoxy)butanoyl-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 119199926 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 2-[4-(4-acetyl-2-methoxyphenoxy)butanoyl-methylamino]-2-methylpropanoic acid |
| SMILES | COc1cc(C(C)=O)ccc1OCCCC(=O)N(C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C18H25NO6/c1-12(20)13-8-9-14(15(11-13)24-5)25-10-6-7-16(21)19(4)18(2,3)17(22)23/h8-9,11H,6-7,10H2,1-5H3,(H,22,23) |
| InChIKey | KXOUPLSLGBKSDB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|