About 2-(hydroxymethyl)benzoic acid
2-(hydroxymethyl)benzoic acid (PubChem CID 11920) has the molecular formula C8H8O3
and a molecular weight of 152.15 g/mol. Its IUPAC name is 2-(hydroxymethyl)benzoic acid.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)benzoic acid |
| PubChem CID | 11920 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | 2-(hydroxymethyl)benzoic acid |
| SMILES | O=C(O)c1ccccc1CO |
| InChI | InChI=1S/C8H8O3/c9-5-6-3-1-2-4-7(6)8(10)11/h1-4,9H,5H2,(H,10,11) |
| InChIKey | MGMNPSAERQZUIM-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(hydroxymethyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)benzoic acid?
The IUPAC name of 2-(hydroxymethyl)benzoic acid (CID 11920) is 2-(hydroxymethyl)benzoic acid.
What is the SMILES notation for 2-(hydroxymethyl)benzoic acid?
The canonical SMILES for 2-(hydroxymethyl)benzoic acid is O=C(O)c1ccccc1CO.
What is the InChIKey of 2-(hydroxymethyl)benzoic acid?
The InChIKey is MGMNPSAERQZUIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3/c9-5-6-3-1-2-4-7(6)8(10)11/h1-4,9H,5H2,(H,10,11).
What are the key properties of 2-(hydroxymethyl)benzoic acid?
2-(hydroxymethyl)benzoic acid has a molecular weight of 152.15 g/mol, XLogP of 0.88, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)benzoic acid is sourced from PubChem (CID 11920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).