C21H23NO3 — CID 119201393
4-[[2-(2,3-dihydro-1H-inden-5-yl)acetyl]amino]-4-phenylbutanoic acid (PubChem CID 119201393) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is 4-[[2-(2,3-dihydro-1H-inden-5-yl)acetyl]amino]-4-phenylbutanoic acid.
| Compound Name | 4-[[2-(2,3-dihydro-1H-inden-5-yl)acetyl]amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 119201393 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 4-[[2-(2,3-dihydro-1H-inden-5-yl)acetyl]amino]-4-phenylbutanoic acid |
| SMILES | O=C(O)CCC(NC(=O)Cc1ccc2c(c1)CCC2)c1ccccc1 |
| InChI | InChI=1S/C21H23NO3/c23-20(14-15-9-10-16-7-4-8-18(16)13-15)22-19(11-12-21(24)25)17-5-2-1-3-6-17/h1-3,5-6,9-10,13,19H,4,7-8,11-12,14H2,(H,22,23)(H,24,25) |
| InChIKey | NUDJAJLEZARTAS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |