C18H23NO3 — CID 11920174
benzyl 2-[[2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]acetate (PubChem CID 11920174) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is benzyl 2-[[2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]acetate.
| Compound Name | benzyl 2-[[2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 11920174 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | benzyl 2-[[2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]acetate |
| SMILES | O=C(C[C@@H]1C[C@H]2CC[C@@H]1C2)NCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H23NO3/c20-17(10-16-9-14-6-7-15(16)8-14)19-11-18(21)22-12-13-4-2-1-3-5-13/h1-5,14-16H,6-12H2,(H,19,20)/t14-,15+,16-/m0/s1 |
| InChIKey | MWFBKVBUPOFNAY-XHSDSOJGSA-N |
| XLogP | 2.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |