C17H21NO4 — CID 119202169
2-[cyclopropyl-[4-(4-methylphenyl)-4-oxobutanoyl]amino]propanoic acid (PubChem CID 119202169) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-[cyclopropyl-[4-(4-methylphenyl)-4-oxobutanoyl]amino]propanoic acid.
| Compound Name | 2-[cyclopropyl-[4-(4-methylphenyl)-4-oxobutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119202169 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 2-[cyclopropyl-[4-(4-methylphenyl)-4-oxobutanoyl]amino]propanoic acid |
| SMILES | Cc1ccc(C(=O)CCC(=O)N(C2CC2)C(C)C(=O)O)cc1 |
| InChI | InChI=1S/C17H21NO4/c1-11-3-5-13(6-4-11)15(19)9-10-16(20)18(14-7-8-14)12(2)17(21)22/h3-6,12,14H,7-10H2,1-2H3,(H,21,22) |
| InChIKey | DAYWXPYXEVDSDB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |