C22H34NO4+ — CID 11920228
(3S,3aR,4aR,8aR,9aR)-3-(1,4-dioxa-8-azoniaspiro[4.5]decan-8-ylmethyl)-8a-methyl-5-methylidene-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one (PubChem CID 11920228) has the molecular formula C22H34NO4+ and a molecular weight of 376.52 g/mol. Its IUPAC name is (3S,3aR,4aR,8aR,9aR)-3-(1,4-dioxa-8-azoniaspiro[4.5]decan-8-ylmethyl)-8a-methyl-5-methylidene-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one.
| Compound Name | (3S,3aR,4aR,8aR,9aR)-3-(1,4-dioxa-8-azoniaspiro[4.5]decan-8-ylmethyl)-8a-methyl-5-methylidene-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 11920228 |
| Molecular Formula | C22H34NO4+ |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | (3S,3aR,4aR,8aR,9aR)-3-(1,4-dioxa-8-azoniaspiro[4.5]decan-8-ylmethyl)-8a-methyl-5-methylidene-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one |
| SMILES | C=C1CCC[C@]2(C)C[C@H]3OC(=O)[C@H](C[NH+]4CCC5(CC4)OCCO5)[C@H]3C[C@H]12 |
| InChI | InChI=1S/C22H33NO4/c1-15-4-3-5-21(2)13-19-16(12-18(15)21)17(20(24)27-19)14-23-8-6-22(7-9-23)25-10-11-26-22/h16-19H,1,3-14H2,2H3/p+1/t16-,17-,18-,19-,21-/m1/s1 |
| InChIKey | PAXXEMKFBLFNJK-DRJBRKBZSA-O |
| XLogP | 1.72 |
| TPSA | 49.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|