C18H24BrNO4 — CID 119203225
2-[[2-[(3-bromophenyl)methyl]-4-methoxybutanoyl]-cyclopropylamino]propanoic acid (PubChem CID 119203225) has the molecular formula C18H24BrNO4 and a molecular weight of 398.30 g/mol. Its IUPAC name is 2-[[2-[(3-bromophenyl)methyl]-4-methoxybutanoyl]-cyclopropylamino]propanoic acid.
| Compound Name | 2-[[2-[(3-bromophenyl)methyl]-4-methoxybutanoyl]-cyclopropylamino]propanoic acid |
|---|---|
| PubChem CID | 119203225 |
| Molecular Formula | C18H24BrNO4 |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 2-[[2-[(3-bromophenyl)methyl]-4-methoxybutanoyl]-cyclopropylamino]propanoic acid |
| SMILES | COCCC(Cc1cccc(Br)c1)C(=O)N(C1CC1)C(C)C(=O)O |
| InChI | InChI=1S/C18H24BrNO4/c1-12(18(22)23)20(16-6-7-16)17(21)14(8-9-24-2)10-13-4-3-5-15(19)11-13/h3-5,11-12,14,16H,6-10H2,1-2H3,(H,22,23) |
| InChIKey | OLTSDKKZRYFRFA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |