C13H13FINO3 — CID 119203567
2-[cyclopropyl-(5-fluoro-2-iodobenzoyl)amino]propanoic acid (PubChem CID 119203567) has the molecular formula C13H13FINO3 and a molecular weight of 377.15 g/mol. Its IUPAC name is 2-[cyclopropyl-(5-fluoro-2-iodobenzoyl)amino]propanoic acid.
| Compound Name | 2-[cyclopropyl-(5-fluoro-2-iodobenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 119203567 |
| Molecular Formula | C13H13FINO3 |
| Molecular Weight | 377.15 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | 2-[cyclopropyl-(5-fluoro-2-iodobenzoyl)amino]propanoic acid |
| SMILES | CC(C(=O)O)N(C(=O)c1cc(F)ccc1I)C1CC1 |
| InChI | InChI=1S/C13H13FINO3/c1-7(13(18)19)16(9-3-4-9)12(17)10-6-8(14)2-5-11(10)15/h2,5-7,9H,3-4H2,1H3,(H,18,19) |
| InChIKey | SJIYGXMGARBNFE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.15 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|