C16H17N3O3 — CID 11920383
(4S,6R,9R)-4,9-dihydroxy-14-methyl-2,8,18-triazatetracyclo[8.8.0.02,6.012,17]octadeca-1(10),11,13,15,17-pentaen-7-one (PubChem CID 11920383) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is (4S,6R,9R)-4,9-dihydroxy-14-methyl-2,8,18-triazatetracyclo[8.8.0.02,6.012,17]octadeca-1(10),11,13,15,17-pentaen-7-one.
| Compound Name | (4S,6R,9R)-4,9-dihydroxy-14-methyl-2,8,18-triazatetracyclo[8.8.0.02,6.012,17]octadeca-1(10),11,13,15,17-pentaen-7-one |
|---|---|
| PubChem CID | 11920383 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (4S,6R,9R)-4,9-dihydroxy-14-methyl-2,8,18-triazatetracyclo[8.8.0.02,6.012,17]octadeca-1(10),11,13,15,17-pentaen-7-one |
| SMILES | Cc1ccc2nc3c(cc2c1)[C@@H](O)NC(=O)[C@H]1C[C@H](O)CN31 |
| InChI | InChI=1S/C16H17N3O3/c1-8-2-3-12-9(4-8)5-11-14(17-12)19-7-10(20)6-13(19)16(22)18-15(11)21/h2-5,10,13,15,20-21H,6-7H2,1H3,(H,18,22)/t10-,13+,15+/m0/s1 |
| InChIKey | GROAKEXQHLMZMB-PSOPSSQASA-N |
| XLogP | 0.60 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |