C21H25NO3 — CID 119204427
4-(3,3-diphenylpropanoylamino)-4-methylpentanoic acid (PubChem CID 119204427) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 4-(3,3-diphenylpropanoylamino)-4-methylpentanoic acid.
| Compound Name | 4-(3,3-diphenylpropanoylamino)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119204427 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 4-(3,3-diphenylpropanoylamino)-4-methylpentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO3/c1-21(2,14-13-20(24)25)22-19(23)15-18(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,18H,13-15H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | MRJZDEDRHCTRND-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |