C16H20ClN3O4 — CID 119204560
4-[[4-chloro-3-(2-oxoimidazolidin-1-yl)benzoyl]amino]-4-methylpentanoic acid (PubChem CID 119204560) has the molecular formula C16H20ClN3O4 and a molecular weight of 353.81 g/mol. Its IUPAC name is 4-[[4-chloro-3-(2-oxoimidazolidin-1-yl)benzoyl]amino]-4-methylpentanoic acid.
| Compound Name | 4-[[4-chloro-3-(2-oxoimidazolidin-1-yl)benzoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119204560 |
| Molecular Formula | C16H20ClN3O4 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 4-[[4-chloro-3-(2-oxoimidazolidin-1-yl)benzoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)c1ccc(Cl)c(N2CCNC2=O)c1 |
| InChI | InChI=1S/C16H20ClN3O4/c1-16(2,6-5-13(21)22)19-14(23)10-3-4-11(17)12(9-10)20-8-7-18-15(20)24/h3-4,9H,5-8H2,1-2H3,(H,18,24)(H,19,23)(H,21,22) |
| InChIKey | OAUCBLZHURRBEK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |