About 2-[(6-oxo-1-phenyl-4,5-dihydropyridazine-3-carbonyl)-propylamino]acetic acid
2-[(6-oxo-1-phenyl-4,5-dihydropyridazine-3-carbonyl)-propylamino]acetic acid (PubChem CID 119204717) has the molecular formula C16H19N3O4
and a molecular weight of 317.34 g/mol. Its IUPAC name is 2-[(6-oxo-1-phenyl-4,5-dihydropyridazine-3-carbonyl)-propylamino]acetic acid.
Molecular Properties
| Compound Name | 2-[(6-oxo-1-phenyl-4,5-dihydropyridazine-3-carbonyl)-propylamino]acetic acid |
| PubChem CID | 119204717 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 2-[(6-oxo-1-phenyl-4,5-dihydropyridazine-3-carbonyl)-propylamino]acetic acid |
| SMILES | CCCN(CC(=O)O)C(=O)C1=NN(c2ccccc2)C(=O)CC1 |
| InChI | InChI=1S/C16H19N3O4/c1-2-10-18(11-15(21)22)16(23)13-8-9-14(20)19(17-13)12-6-4-3-5-7-12/h3-7H,2,8-11H2,1H3,(H,21,22) |
| InChIKey | ILSSLHRFAZYVFD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(6-oxo-1-phenyl-4,5-dihydropyridazine-3-carbonyl)-propylamino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-oxo-1-phenyl-4,5-dihydropyridazine-3-carbonyl)-propylamino]acetic acid?
The IUPAC name of 2-[(6-oxo-1-phenyl-4,5-dihydropyridazine-3-carbonyl)-propylamino]acetic acid (CID 119204717) is 2-[(6-oxo-1-phenyl-4,5-dihydropyridazine-3-carbonyl)-propylamino]acetic acid.
What is the SMILES notation for 2-[(6-oxo-1-phenyl-4,5-dihydropyridazine-3-carbonyl)-propylamino]acetic acid?
The canonical SMILES for 2-[(6-oxo-1-phenyl-4,5-dihydropyridazine-3-carbonyl)-propylamino]acetic acid is CCCN(CC(=O)O)C(=O)C1=NN(c2ccccc2)C(=O)CC1.
What is the InChIKey of 2-[(6-oxo-1-phenyl-4,5-dihydropyridazine-3-carbonyl)-propylamino]acetic acid?
The InChIKey is ILSSLHRFAZYVFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O4/c1-2-10-18(11-15(21)22)16(23)13-8-9-14(20)19(17-13)12-6-4-3-5-7-12/h3-7H,2,8-11H2,1H3,(H,21,22).
What are the key properties of 2-[(6-oxo-1-phenyl-4,5-dihydropyridazine-3-carbonyl)-propylamino]acetic acid?
2-[(6-oxo-1-phenyl-4,5-dihydropyridazine-3-carbonyl)-propylamino]acetic acid has a molecular weight of 317.34 g/mol, XLogP of 1.49, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-oxo-1-phenyl-4,5-dihydropyridazine-3-carbonyl)-propylamino]acetic acid is sourced from PubChem (CID 119204717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).