About [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-[(4-methylphenyl)methyl]azanium
[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-[(4-methylphenyl)methyl]azanium (PubChem CID 11920515) has the molecular formula C16H22N+
and a molecular weight of 228.36 g/mol. Its IUPAC name is [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-[(4-methylphenyl)methyl]azanium.
Molecular Properties
| Compound Name | [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-[(4-methylphenyl)methyl]azanium |
| PubChem CID | 11920515 |
| Molecular Formula | C16H22N+ |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-[(4-methylphenyl)methyl]azanium |
| SMILES | Cc1ccc(C[NH2+]C[C@H]2C[C@@H]3C=C[C@H]2C3)cc1 |
| InChI | InChI=1S/C16H21N/c1-12-2-4-13(5-3-12)10-17-11-16-9-14-6-7-15(16)8-14/h2-7,14-17H,8-11H2,1H3/p+1/t14-,15+,16-/m1/s1 |
| InChIKey | BQAZIASDICQKEG-OWCLPIDISA-O |
| XLogP | 2.27 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-[(4-methylphenyl)methyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-[(4-methylphenyl)methyl]azanium?
The IUPAC name of [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-[(4-methylphenyl)methyl]azanium (CID 11920515) is [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-[(4-methylphenyl)methyl]azanium.
What is the SMILES notation for [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-[(4-methylphenyl)methyl]azanium?
The canonical SMILES for [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-[(4-methylphenyl)methyl]azanium is Cc1ccc(C[NH2+]C[C@H]2C[C@@H]3C=C[C@H]2C3)cc1.
What is the InChIKey of [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-[(4-methylphenyl)methyl]azanium?
The InChIKey is BQAZIASDICQKEG-OWCLPIDISA-O. The full InChI is InChI=1S/C16H21N/c1-12-2-4-13(5-3-12)10-17-11-16-9-14-6-7-15(16)8-14/h2-7,14-17H,8-11H2,1H3/p+1/t14-,15+,16-/m1/s1.
What are the key properties of [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-[(4-methylphenyl)methyl]azanium?
[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-[(4-methylphenyl)methyl]azanium has a molecular weight of 228.36 g/mol, XLogP of 2.27, 4 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-[(4-methylphenyl)methyl]azanium is sourced from PubChem (CID 11920515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).