C16H22N+ — CID 11920515
[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-[(4-methylphenyl)methyl]azanium (PubChem CID 11920515) has the molecular formula C16H22N+ and a molecular weight of 228.36 g/mol. Its IUPAC name is [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-[(4-methylphenyl)methyl]azanium.
| Compound Name | [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-[(4-methylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 11920515 |
| Molecular Formula | C16H22N+ |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-[(4-methylphenyl)methyl]azanium |
| SMILES | Cc1ccc(C[NH2+]C[C@H]2C[C@@H]3C=C[C@H]2C3)cc1 |
| InChI | InChI=1S/C16H21N/c1-12-2-4-13(5-3-12)10-17-11-16-9-14-6-7-15(16)8-14/h2-7,14-17H,8-11H2,1H3/p+1/t14-,15+,16-/m1/s1 |
| InChIKey | BQAZIASDICQKEG-OWCLPIDISA-O |
| XLogP | 2.27 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|