C16H18FN3O3 — CID 119206835
3-[[1-(2-fluorophenyl)pyrazole-3-carbonyl]-propan-2-ylamino]propanoic acid (PubChem CID 119206835) has the molecular formula C16H18FN3O3 and a molecular weight of 319.34 g/mol. Its IUPAC name is 3-[[1-(2-fluorophenyl)pyrazole-3-carbonyl]-propan-2-ylamino]propanoic acid.
| Compound Name | 3-[[1-(2-fluorophenyl)pyrazole-3-carbonyl]-propan-2-ylamino]propanoic acid |
|---|---|
| PubChem CID | 119206835 |
| Molecular Formula | C16H18FN3O3 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 3-[[1-(2-fluorophenyl)pyrazole-3-carbonyl]-propan-2-ylamino]propanoic acid |
| SMILES | CC(C)N(CCC(=O)O)C(=O)c1ccn(-c2ccccc2F)n1 |
| InChI | InChI=1S/C16H18FN3O3/c1-11(2)19(9-8-15(21)22)16(23)13-7-10-20(18-13)14-6-4-3-5-12(14)17/h3-7,10-11H,8-9H2,1-2H3,(H,21,22) |
| InChIKey | VGHUKPIGMOZPMU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |