About 3-[(4-methyl-2-propyl-1,3-thiazole-5-carbonyl)-propan-2-ylamino]propanoic acid
3-[(4-methyl-2-propyl-1,3-thiazole-5-carbonyl)-propan-2-ylamino]propanoic acid (PubChem CID 119207759) has the molecular formula C14H22N2O3S
and a molecular weight of 298.41 g/mol. Its IUPAC name is 3-[(4-methyl-2-propyl-1,3-thiazole-5-carbonyl)-propan-2-ylamino]propanoic acid.
Molecular Properties
| Compound Name | 3-[(4-methyl-2-propyl-1,3-thiazole-5-carbonyl)-propan-2-ylamino]propanoic acid |
| PubChem CID | 119207759 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 3-[(4-methyl-2-propyl-1,3-thiazole-5-carbonyl)-propan-2-ylamino]propanoic acid |
| SMILES | CCCc1nc(C)c(C(=O)N(CCC(=O)O)C(C)C)s1 |
| InChI | InChI=1S/C14H22N2O3S/c1-5-6-11-15-10(4)13(20-11)14(19)16(9(2)3)8-7-12(17)18/h9H,5-8H2,1-4H3,(H,17,18) |
| InChIKey | IHOQXKAVMZKFBC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(4-methyl-2-propyl-1,3-thiazole-5-carbonyl)-propan-2-ylamino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-methyl-2-propyl-1,3-thiazole-5-carbonyl)-propan-2-ylamino]propanoic acid?
The IUPAC name of 3-[(4-methyl-2-propyl-1,3-thiazole-5-carbonyl)-propan-2-ylamino]propanoic acid (CID 119207759) is 3-[(4-methyl-2-propyl-1,3-thiazole-5-carbonyl)-propan-2-ylamino]propanoic acid.
What is the SMILES notation for 3-[(4-methyl-2-propyl-1,3-thiazole-5-carbonyl)-propan-2-ylamino]propanoic acid?
The canonical SMILES for 3-[(4-methyl-2-propyl-1,3-thiazole-5-carbonyl)-propan-2-ylamino]propanoic acid is CCCc1nc(C)c(C(=O)N(CCC(=O)O)C(C)C)s1.
What is the InChIKey of 3-[(4-methyl-2-propyl-1,3-thiazole-5-carbonyl)-propan-2-ylamino]propanoic acid?
The InChIKey is IHOQXKAVMZKFBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O3S/c1-5-6-11-15-10(4)13(20-11)14(19)16(9(2)3)8-7-12(17)18/h9H,5-8H2,1-4H3,(H,17,18).
What are the key properties of 3-[(4-methyl-2-propyl-1,3-thiazole-5-carbonyl)-propan-2-ylamino]propanoic acid?
3-[(4-methyl-2-propyl-1,3-thiazole-5-carbonyl)-propan-2-ylamino]propanoic acid has a molecular weight of 298.41 g/mol, XLogP of 2.73, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-methyl-2-propyl-1,3-thiazole-5-carbonyl)-propan-2-ylamino]propanoic acid is sourced from PubChem (CID 119207759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).