About 3-[(3,4-difluorophenyl)methyl-(1-ethylpyrazole-4-carbonyl)amino]propanoic acid
3-[(3,4-difluorophenyl)methyl-(1-ethylpyrazole-4-carbonyl)amino]propanoic acid (PubChem CID 119208028) has the molecular formula C16H17F2N3O3
and a molecular weight of 337.33 g/mol. Its IUPAC name is 3-[(3,4-difluorophenyl)methyl-(1-ethylpyrazole-4-carbonyl)amino]propanoic acid.
Molecular Properties
| Compound Name | 3-[(3,4-difluorophenyl)methyl-(1-ethylpyrazole-4-carbonyl)amino]propanoic acid |
| PubChem CID | 119208028 |
| Molecular Formula | C16H17F2N3O3 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 3-[(3,4-difluorophenyl)methyl-(1-ethylpyrazole-4-carbonyl)amino]propanoic acid |
| SMILES | CCn1cc(C(=O)N(CCC(=O)O)Cc2ccc(F)c(F)c2)cn1 |
| InChI | InChI=1S/C16H17F2N3O3/c1-2-21-10-12(8-19-21)16(24)20(6-5-15(22)23)9-11-3-4-13(17)14(18)7-11/h3-4,7-8,10H,2,5-6,9H2,1H3,(H,22,23) |
| InChIKey | XVBVNRMHMZBIHS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(3,4-difluorophenyl)methyl-(1-ethylpyrazole-4-carbonyl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,4-difluorophenyl)methyl-(1-ethylpyrazole-4-carbonyl)amino]propanoic acid?
The IUPAC name of 3-[(3,4-difluorophenyl)methyl-(1-ethylpyrazole-4-carbonyl)amino]propanoic acid (CID 119208028) is 3-[(3,4-difluorophenyl)methyl-(1-ethylpyrazole-4-carbonyl)amino]propanoic acid.
What is the SMILES notation for 3-[(3,4-difluorophenyl)methyl-(1-ethylpyrazole-4-carbonyl)amino]propanoic acid?
The canonical SMILES for 3-[(3,4-difluorophenyl)methyl-(1-ethylpyrazole-4-carbonyl)amino]propanoic acid is CCn1cc(C(=O)N(CCC(=O)O)Cc2ccc(F)c(F)c2)cn1.
What is the InChIKey of 3-[(3,4-difluorophenyl)methyl-(1-ethylpyrazole-4-carbonyl)amino]propanoic acid?
The InChIKey is XVBVNRMHMZBIHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F2N3O3/c1-2-21-10-12(8-19-21)16(24)20(6-5-15(22)23)9-11-3-4-13(17)14(18)7-11/h3-4,7-8,10H,2,5-6,9H2,1H3,(H,22,23).
What are the key properties of 3-[(3,4-difluorophenyl)methyl-(1-ethylpyrazole-4-carbonyl)amino]propanoic acid?
3-[(3,4-difluorophenyl)methyl-(1-ethylpyrazole-4-carbonyl)amino]propanoic acid has a molecular weight of 337.33 g/mol, XLogP of 2.30, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,4-difluorophenyl)methyl-(1-ethylpyrazole-4-carbonyl)amino]propanoic acid is sourced from PubChem (CID 119208028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).