C16H19N3O3 — CID 119208682
2-[methyl-[5-methyl-1-(3-methylphenyl)pyrazole-4-carbonyl]amino]propanoic acid (PubChem CID 119208682) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-[methyl-[5-methyl-1-(3-methylphenyl)pyrazole-4-carbonyl]amino]propanoic acid.
| Compound Name | 2-[methyl-[5-methyl-1-(3-methylphenyl)pyrazole-4-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119208682 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-[methyl-[5-methyl-1-(3-methylphenyl)pyrazole-4-carbonyl]amino]propanoic acid |
| SMILES | Cc1cccc(-n2ncc(C(=O)N(C)C(C)C(=O)O)c2C)c1 |
| InChI | InChI=1S/C16H19N3O3/c1-10-6-5-7-13(8-10)19-11(2)14(9-17-19)15(20)18(4)12(3)16(21)22/h5-9,12H,1-4H3,(H,21,22) |
| InChIKey | JUSSQHWYFVGODW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |