C17H19NO4 — CID 119209158
2-[[5-(4-ethylphenyl)furan-2-carbonyl]-methylamino]propanoic acid (PubChem CID 119209158) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is 2-[[5-(4-ethylphenyl)furan-2-carbonyl]-methylamino]propanoic acid.
| Compound Name | 2-[[5-(4-ethylphenyl)furan-2-carbonyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 119209158 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-[[5-(4-ethylphenyl)furan-2-carbonyl]-methylamino]propanoic acid |
| SMILES | CCc1ccc(-c2ccc(C(=O)N(C)C(C)C(=O)O)o2)cc1 |
| InChI | InChI=1S/C17H19NO4/c1-4-12-5-7-13(8-6-12)14-9-10-15(22-14)16(19)18(3)11(2)17(20)21/h5-11H,4H2,1-3H3,(H,20,21) |
| InChIKey | VKMVJTCVFOKONC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |