C21H26N2O4 — CID 119210017
3-[(4-acetyl-1-methylpyrrole-2-carbonyl)amino]-3-(4-tert-butylphenyl)propanoic acid (PubChem CID 119210017) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 3-[(4-acetyl-1-methylpyrrole-2-carbonyl)amino]-3-(4-tert-butylphenyl)propanoic acid.
| Compound Name | 3-[(4-acetyl-1-methylpyrrole-2-carbonyl)amino]-3-(4-tert-butylphenyl)propanoic acid |
|---|---|
| PubChem CID | 119210017 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 3-[(4-acetyl-1-methylpyrrole-2-carbonyl)amino]-3-(4-tert-butylphenyl)propanoic acid |
| SMILES | CC(=O)c1cc(C(=O)NC(CC(=O)O)c2ccc(C(C)(C)C)cc2)n(C)c1 |
| InChI | InChI=1S/C21H26N2O4/c1-13(24)15-10-18(23(5)12-15)20(27)22-17(11-19(25)26)14-6-8-16(9-7-14)21(2,3)4/h6-10,12,17H,11H2,1-5H3,(H,22,27)(H,25,26) |
| InChIKey | WWQZNPNEADGVSN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |