About 2-[[2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetyl]-(oxan-4-yl)amino]acetic acid
2-[[2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetyl]-(oxan-4-yl)amino]acetic acid (PubChem CID 119211197) has the molecular formula C18H29N3O4
and a molecular weight of 351.45 g/mol. Its IUPAC name is 2-[[2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetyl]-(oxan-4-yl)amino]acetic acid.
Molecular Properties
| Compound Name | 2-[[2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetyl]-(oxan-4-yl)amino]acetic acid |
| PubChem CID | 119211197 |
| Molecular Formula | C18H29N3O4 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 2-[[2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetyl]-(oxan-4-yl)amino]acetic acid |
| SMILES | Cc1nn(CC(C)C)c(C)c1CC(=O)N(CC(=O)O)C1CCOCC1 |
| InChI | InChI=1S/C18H29N3O4/c1-12(2)10-21-14(4)16(13(3)19-21)9-17(22)20(11-18(23)24)15-5-7-25-8-6-15/h12,15H,5-11H2,1-4H3,(H,23,24) |
| InChIKey | GHYXBSSXVGKJQZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetyl]-(oxan-4-yl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetyl]-(oxan-4-yl)amino]acetic acid?
The IUPAC name of 2-[[2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetyl]-(oxan-4-yl)amino]acetic acid (CID 119211197) is 2-[[2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetyl]-(oxan-4-yl)amino]acetic acid.
What is the SMILES notation for 2-[[2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetyl]-(oxan-4-yl)amino]acetic acid?
The canonical SMILES for 2-[[2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetyl]-(oxan-4-yl)amino]acetic acid is Cc1nn(CC(C)C)c(C)c1CC(=O)N(CC(=O)O)C1CCOCC1.
What is the InChIKey of 2-[[2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetyl]-(oxan-4-yl)amino]acetic acid?
The InChIKey is GHYXBSSXVGKJQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29N3O4/c1-12(2)10-21-14(4)16(13(3)19-21)9-17(22)20(11-18(23)24)15-5-7-25-8-6-15/h12,15H,5-11H2,1-4H3,(H,23,24).
What are the key properties of 2-[[2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetyl]-(oxan-4-yl)amino]acetic acid?
2-[[2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetyl]-(oxan-4-yl)amino]acetic acid has a molecular weight of 351.45 g/mol, XLogP of 1.79, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetyl]-(oxan-4-yl)amino]acetic acid is sourced from PubChem (CID 119211197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).