C16H22FNO4 — CID 119211432
2-[4-(3-fluorophenoxy)butanoylamino]-3-methylpentanoic acid (PubChem CID 119211432) has the molecular formula C16H22FNO4 and a molecular weight of 311.35 g/mol. Its IUPAC name is 2-[4-(3-fluorophenoxy)butanoylamino]-3-methylpentanoic acid.
| Compound Name | 2-[4-(3-fluorophenoxy)butanoylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 119211432 |
| Molecular Formula | C16H22FNO4 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 2-[4-(3-fluorophenoxy)butanoylamino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)CCCOc1cccc(F)c1)C(=O)O |
| InChI | InChI=1S/C16H22FNO4/c1-3-11(2)15(16(20)21)18-14(19)8-5-9-22-13-7-4-6-12(17)10-13/h4,6-7,10-11,15H,3,5,8-9H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | QOSLGDOMLVNXGV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|