C17H24N2O4 — CID 119211823
2-[[3-[ethyl(methyl)carbamoyl]benzoyl]amino]-3-methylpentanoic acid (PubChem CID 119211823) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-[[3-[ethyl(methyl)carbamoyl]benzoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[3-[ethyl(methyl)carbamoyl]benzoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 119211823 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 2-[[3-[ethyl(methyl)carbamoyl]benzoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)c1cccc(C(=O)N(C)CC)c1)C(=O)O |
| InChI | InChI=1S/C17H24N2O4/c1-5-11(3)14(17(22)23)18-15(20)12-8-7-9-13(10-12)16(21)19(4)6-2/h7-11,14H,5-6H2,1-4H3,(H,18,20)(H,22,23) |
| InChIKey | PBBNCBGQQPNFRL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |