C17H26N2O6S — CID 119212048
3-methyl-2-[[2-[(4-propan-2-yloxyphenyl)sulfamoyl]acetyl]amino]pentanoic acid (PubChem CID 119212048) has the molecular formula C17H26N2O6S and a molecular weight of 386.47 g/mol. Its IUPAC name is 3-methyl-2-[[2-[(4-propan-2-yloxyphenyl)sulfamoyl]acetyl]amino]pentanoic acid.
| Compound Name | 3-methyl-2-[[2-[(4-propan-2-yloxyphenyl)sulfamoyl]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119212048 |
| Molecular Formula | C17H26N2O6S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 3-methyl-2-[[2-[(4-propan-2-yloxyphenyl)sulfamoyl]acetyl]amino]pentanoic acid |
| SMILES | CCC(C)C(NC(=O)CS(=O)(=O)Nc1ccc(OC(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C17H26N2O6S/c1-5-12(4)16(17(21)22)18-15(20)10-26(23,24)19-13-6-8-14(9-7-13)25-11(2)3/h6-9,11-12,16,19H,5,10H2,1-4H3,(H,18,20)(H,21,22) |
| InChIKey | JDNNMCXTAVWRBO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |