C18H22FNO4 — CID 119212400
3-[[2-(3-fluorophenyl)cyclopropanecarbonyl]-(oxan-4-yl)amino]propanoic acid (PubChem CID 119212400) has the molecular formula C18H22FNO4 and a molecular weight of 335.38 g/mol. Its IUPAC name is 3-[[2-(3-fluorophenyl)cyclopropanecarbonyl]-(oxan-4-yl)amino]propanoic acid.
| Compound Name | 3-[[2-(3-fluorophenyl)cyclopropanecarbonyl]-(oxan-4-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 119212400 |
| Molecular Formula | C18H22FNO4 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 3-[[2-(3-fluorophenyl)cyclopropanecarbonyl]-(oxan-4-yl)amino]propanoic acid |
| SMILES | O=C(O)CCN(C(=O)C1CC1c1cccc(F)c1)C1CCOCC1 |
| InChI | InChI=1S/C18H22FNO4/c19-13-3-1-2-12(10-13)15-11-16(15)18(23)20(7-4-17(21)22)14-5-8-24-9-6-14/h1-3,10,14-16H,4-9,11H2,(H,21,22) |
| InChIKey | SHVKBRGLQBZCKF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |