C22H26N2O2 — CID 11921405
[(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] propanoate (PubChem CID 11921405) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is [(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] propanoate.
| Compound Name | [(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] propanoate |
|---|---|
| PubChem CID | 11921405 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | [(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] propanoate |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@@H](OC(=O)CC)c1ccnc2ccccc12 |
| InChI | InChI=1S/C22H26N2O2/c1-3-15-14-24-12-10-16(15)13-20(24)22(26-21(25)4-2)18-9-11-23-19-8-6-5-7-17(18)19/h3,5-9,11,15-16,20,22H,1,4,10,12-14H2,2H3/t15-,16-,20+,22-/m0/s1 |
| InChIKey | HXIOQHAJPMQTTN-CVWFHCBDSA-N |
| XLogP | 4.13 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|