C18H22N2O4S — CID 11921455
(1S,2S,5R)-2-[5-(1-adamantyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]-6,8-dioxabicyclo[3.2.1]octan-4-one (PubChem CID 11921455) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is (1S,2S,5R)-2-[5-(1-adamantyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]-6,8-dioxabicyclo[3.2.1]octan-4-one.
| Compound Name | (1S,2S,5R)-2-[5-(1-adamantyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]-6,8-dioxabicyclo[3.2.1]octan-4-one |
|---|---|
| PubChem CID | 11921455 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | (1S,2S,5R)-2-[5-(1-adamantyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]-6,8-dioxabicyclo[3.2.1]octan-4-one |
| SMILES | O=C1C[C@H](n2nc(C34CC5CC(CC(C5)C3)C4)oc2=S)[C@H]2CO[C@@H]1O2 |
| InChI | InChI=1S/C18H22N2O4S/c21-13-4-12(14-8-22-15(13)23-14)20-17(25)24-16(19-20)18-5-9-1-10(6-18)3-11(2-9)7-18/h9-12,14-15H,1-8H2/t9?,10?,11?,12-,14+,15+,18?/m0/s1 |
| InChIKey | WMNBRSOAKOGCEM-YTFNZORRSA-N |
| XLogP | 2.93 |
| TPSA | 66.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|