C17H29NO4 — CID 119214680
2-[4-(3-cyclohexylbutanoylamino)oxan-4-yl]acetic acid (PubChem CID 119214680) has the molecular formula C17H29NO4 and a molecular weight of 311.42 g/mol. Its IUPAC name is 2-[4-(3-cyclohexylbutanoylamino)oxan-4-yl]acetic acid.
| Compound Name | 2-[4-(3-cyclohexylbutanoylamino)oxan-4-yl]acetic acid |
|---|---|
| PubChem CID | 119214680 |
| Molecular Formula | C17H29NO4 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | 2-[4-(3-cyclohexylbutanoylamino)oxan-4-yl]acetic acid |
| SMILES | CC(CC(=O)NC1(CC(=O)O)CCOCC1)C1CCCCC1 |
| InChI | InChI=1S/C17H29NO4/c1-13(14-5-3-2-4-6-14)11-15(19)18-17(12-16(20)21)7-9-22-10-8-17/h13-14H,2-12H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | FDCPFMJPCMNXBO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |