C17H23NO6S — CID 119214834
2-[4-[[2-(4-ethylsulfonylphenyl)acetyl]amino]oxan-4-yl]acetic acid (PubChem CID 119214834) has the molecular formula C17H23NO6S and a molecular weight of 369.44 g/mol. Its IUPAC name is 2-[4-[[2-(4-ethylsulfonylphenyl)acetyl]amino]oxan-4-yl]acetic acid.
| Compound Name | 2-[4-[[2-(4-ethylsulfonylphenyl)acetyl]amino]oxan-4-yl]acetic acid |
|---|---|
| PubChem CID | 119214834 |
| Molecular Formula | C17H23NO6S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-[4-[[2-(4-ethylsulfonylphenyl)acetyl]amino]oxan-4-yl]acetic acid |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)NC2(CC(=O)O)CCOCC2)cc1 |
| InChI | InChI=1S/C17H23NO6S/c1-2-25(22,23)14-5-3-13(4-6-14)11-15(19)18-17(12-16(20)21)7-9-24-10-8-17/h3-6H,2,7-12H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | JMKNKFMTQSMZAR-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |