C17H20N2O5S — CID 119215873
4-[1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carbonyl]morpholine-3-carboxylic acid (PubChem CID 119215873) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is 4-[1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carbonyl]morpholine-3-carboxylic acid.
| Compound Name | 4-[1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carbonyl]morpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 119215873 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 4-[1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carbonyl]morpholine-3-carboxylic acid |
| SMILES | CSc1ccc(N2CC(C(=O)N3CCOCC3C(=O)O)CC2=O)cc1 |
| InChI | InChI=1S/C17H20N2O5S/c1-25-13-4-2-12(3-5-13)19-9-11(8-15(19)20)16(21)18-6-7-24-10-14(18)17(22)23/h2-5,11,14H,6-10H2,1H3,(H,22,23) |
| InChIKey | YVDNMTYGERXCGH-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |