C11H13NO5S — CID 119215960
4-(5-methylsulfanylfuran-2-carbonyl)morpholine-3-carboxylic acid (PubChem CID 119215960) has the molecular formula C11H13NO5S and a molecular weight of 271.29 g/mol. Its IUPAC name is 4-(5-methylsulfanylfuran-2-carbonyl)morpholine-3-carboxylic acid.
| Compound Name | 4-(5-methylsulfanylfuran-2-carbonyl)morpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 119215960 |
| Molecular Formula | C11H13NO5S |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 4-(5-methylsulfanylfuran-2-carbonyl)morpholine-3-carboxylic acid |
| SMILES | CSc1ccc(C(=O)N2CCOCC2C(=O)O)o1 |
| InChI | InChI=1S/C11H13NO5S/c1-18-9-3-2-8(17-9)10(13)12-4-5-16-6-7(12)11(14)15/h2-3,7H,4-6H2,1H3,(H,14,15) |
| InChIKey | QSFCEUZIKUWERS-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |