About 4-(1-cyclohexyl-2,5-dimethylpyrrole-3-carbonyl)morpholine-3-carboxylic acid
4-(1-cyclohexyl-2,5-dimethylpyrrole-3-carbonyl)morpholine-3-carboxylic acid (PubChem CID 119216360) has the molecular formula C18H26N2O4
and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-(1-cyclohexyl-2,5-dimethylpyrrole-3-carbonyl)morpholine-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-(1-cyclohexyl-2,5-dimethylpyrrole-3-carbonyl)morpholine-3-carboxylic acid |
| PubChem CID | 119216360 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 4-(1-cyclohexyl-2,5-dimethylpyrrole-3-carbonyl)morpholine-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)N2CCOCC2C(=O)O)c(C)n1C1CCCCC1 |
| InChI | InChI=1S/C18H26N2O4/c1-12-10-15(13(2)20(12)14-6-4-3-5-7-14)17(21)19-8-9-24-11-16(19)18(22)23/h10,14,16H,3-9,11H2,1-2H3,(H,22,23) |
| InChIKey | NQQZUCHAXFCBMC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1-cyclohexyl-2,5-dimethylpyrrole-3-carbonyl)morpholine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-cyclohexyl-2,5-dimethylpyrrole-3-carbonyl)morpholine-3-carboxylic acid?
The IUPAC name of 4-(1-cyclohexyl-2,5-dimethylpyrrole-3-carbonyl)morpholine-3-carboxylic acid (CID 119216360) is 4-(1-cyclohexyl-2,5-dimethylpyrrole-3-carbonyl)morpholine-3-carboxylic acid.
What is the SMILES notation for 4-(1-cyclohexyl-2,5-dimethylpyrrole-3-carbonyl)morpholine-3-carboxylic acid?
The canonical SMILES for 4-(1-cyclohexyl-2,5-dimethylpyrrole-3-carbonyl)morpholine-3-carboxylic acid is Cc1cc(C(=O)N2CCOCC2C(=O)O)c(C)n1C1CCCCC1.
What is the InChIKey of 4-(1-cyclohexyl-2,5-dimethylpyrrole-3-carbonyl)morpholine-3-carboxylic acid?
The InChIKey is NQQZUCHAXFCBMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O4/c1-12-10-15(13(2)20(12)14-6-4-3-5-7-14)17(21)19-8-9-24-11-16(19)18(22)23/h10,14,16H,3-9,11H2,1-2H3,(H,22,23).
What are the key properties of 4-(1-cyclohexyl-2,5-dimethylpyrrole-3-carbonyl)morpholine-3-carboxylic acid?
4-(1-cyclohexyl-2,5-dimethylpyrrole-3-carbonyl)morpholine-3-carboxylic acid has a molecular weight of 334.42 g/mol, XLogP of 2.54, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-cyclohexyl-2,5-dimethylpyrrole-3-carbonyl)morpholine-3-carboxylic acid is sourced from PubChem (CID 119216360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).