C14H11F6NO4 — CID 119216480
4-[3,5-bis(trifluoromethyl)benzoyl]morpholine-3-carboxylic acid (PubChem CID 119216480) has the molecular formula C14H11F6NO4 and a molecular weight of 371.23 g/mol. Its IUPAC name is 4-[3,5-bis(trifluoromethyl)benzoyl]morpholine-3-carboxylic acid.
| Compound Name | 4-[3,5-bis(trifluoromethyl)benzoyl]morpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 119216480 |
| Molecular Formula | C14H11F6NO4 |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 4-[3,5-bis(trifluoromethyl)benzoyl]morpholine-3-carboxylic acid |
| SMILES | O=C(O)C1COCCN1C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H11F6NO4/c15-13(16,17)8-3-7(4-9(5-8)14(18,19)20)11(22)21-1-2-25-6-10(21)12(23)24/h3-5,10H,1-2,6H2,(H,23,24) |
| InChIKey | XEQYUONBRGFGFS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |