C15H15N5O6 — CID 119216974
4-[5-methyl-1-(3-nitrophenyl)triazole-4-carbonyl]morpholine-3-carboxylic acid (PubChem CID 119216974) has the molecular formula C15H15N5O6 and a molecular weight of 361.31 g/mol. Its IUPAC name is 4-[5-methyl-1-(3-nitrophenyl)triazole-4-carbonyl]morpholine-3-carboxylic acid.
| Compound Name | 4-[5-methyl-1-(3-nitrophenyl)triazole-4-carbonyl]morpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 119216974 |
| Molecular Formula | C15H15N5O6 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 4-[5-methyl-1-(3-nitrophenyl)triazole-4-carbonyl]morpholine-3-carboxylic acid |
| SMILES | Cc1c(C(=O)N2CCOCC2C(=O)O)nnn1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H15N5O6/c1-9-13(14(21)18-5-6-26-8-12(18)15(22)23)16-17-19(9)10-3-2-4-11(7-10)20(24)25/h2-4,7,12H,5-6,8H2,1H3,(H,22,23) |
| InChIKey | ICSDTZWMYVHZJT-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 140.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|