About N-cyclohexyl-2-[3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl]oxyacetamide
N-cyclohexyl-2-[3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl]oxyacetamide (PubChem CID 1192173) has the molecular formula C25H27NO5
and a molecular weight of 421.49 g/mol. Its IUPAC name is N-cyclohexyl-2-[3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl]oxyacetamide.
Molecular Properties
| Compound Name | N-cyclohexyl-2-[3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl]oxyacetamide |
| PubChem CID | 1192173 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | N-cyclohexyl-2-[3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl]oxyacetamide |
| SMILES | Cc1cc(C)cc(Oc2coc3cc(OCC(=O)NC4CCCCC4)ccc3c2=O)c1 |
| InChI | InChI=1S/C25H27NO5/c1-16-10-17(2)12-20(11-16)31-23-14-30-22-13-19(8-9-21(22)25(23)28)29-15-24(27)26-18-6-4-3-5-7-18/h8-14,18H,3-7,15H2,1-2H3,(H,26,27) |
| InChIKey | NQGQUFMZGGVXDU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-cyclohexyl-2-[3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl]oxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-2-[3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl]oxyacetamide?
The IUPAC name of N-cyclohexyl-2-[3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl]oxyacetamide (CID 1192173) is N-cyclohexyl-2-[3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl]oxyacetamide.
What is the SMILES notation for N-cyclohexyl-2-[3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl]oxyacetamide?
The canonical SMILES for N-cyclohexyl-2-[3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl]oxyacetamide is Cc1cc(C)cc(Oc2coc3cc(OCC(=O)NC4CCCCC4)ccc3c2=O)c1.
What is the InChIKey of N-cyclohexyl-2-[3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl]oxyacetamide?
The InChIKey is NQGQUFMZGGVXDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27NO5/c1-16-10-17(2)12-20(11-16)31-23-14-30-22-13-19(8-9-21(22)25(23)28)29-15-24(27)26-18-6-4-3-5-7-18/h8-14,18H,3-7,15H2,1-2H3,(H,26,27).
What are the key properties of N-cyclohexyl-2-[3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl]oxyacetamide?
N-cyclohexyl-2-[3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl]oxyacetamide has a molecular weight of 421.49 g/mol, XLogP of 5.03, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-2-[3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl]oxyacetamide is sourced from PubChem (CID 1192173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).