C18H22N2O5 — CID 119217840
2-[1-[[1-(4-methoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]cyclobutyl]acetic acid (PubChem CID 119217840) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is 2-[1-[[1-(4-methoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[[1-(4-methoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 119217840 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 2-[1-[[1-(4-methoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]cyclobutyl]acetic acid |
| SMILES | COc1ccc(N2CC(C(=O)NC3(CC(=O)O)CCC3)CC2=O)cc1 |
| InChI | InChI=1S/C18H22N2O5/c1-25-14-5-3-13(4-6-14)20-11-12(9-15(20)21)17(24)19-18(7-2-8-18)10-16(22)23/h3-6,12H,2,7-11H2,1H3,(H,19,24)(H,22,23) |
| InChIKey | WHTMTUFVWDRLJV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |