C16H21NO5 — CID 119217956
2-[1-[[2-(4-ethoxyphenoxy)acetyl]amino]cyclobutyl]acetic acid (PubChem CID 119217956) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-[1-[[2-(4-ethoxyphenoxy)acetyl]amino]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[[2-(4-ethoxyphenoxy)acetyl]amino]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 119217956 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2-[1-[[2-(4-ethoxyphenoxy)acetyl]amino]cyclobutyl]acetic acid |
| SMILES | CCOc1ccc(OCC(=O)NC2(CC(=O)O)CCC2)cc1 |
| InChI | InChI=1S/C16H21NO5/c1-2-21-12-4-6-13(7-5-12)22-11-14(18)17-16(8-3-9-16)10-15(19)20/h4-7H,2-3,8-11H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | VYQQCPDIXKGSDZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |