C15H17N5O3 — CID 119218102
2-[1-[[2-[4-(tetrazol-1-yl)phenyl]acetyl]amino]cyclobutyl]acetic acid (PubChem CID 119218102) has the molecular formula C15H17N5O3 and a molecular weight of 315.33 g/mol. Its IUPAC name is 2-[1-[[2-[4-(tetrazol-1-yl)phenyl]acetyl]amino]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[[2-[4-(tetrazol-1-yl)phenyl]acetyl]amino]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 119218102 |
| Molecular Formula | C15H17N5O3 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 2-[1-[[2-[4-(tetrazol-1-yl)phenyl]acetyl]amino]cyclobutyl]acetic acid |
| SMILES | O=C(O)CC1(NC(=O)Cc2ccc(-n3cnnn3)cc2)CCC1 |
| InChI | InChI=1S/C15H17N5O3/c21-13(17-15(6-1-7-15)9-14(22)23)8-11-2-4-12(5-3-11)20-10-16-18-19-20/h2-5,10H,1,6-9H2,(H,17,21)(H,22,23) |
| InChIKey | OWSWSWIAEQYDTK-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |