C22H24N2O3 — CID 119218961
3-[[2-(1-ethylindol-3-yl)acetyl]amino]-2-methyl-3-phenylpropanoic acid (PubChem CID 119218961) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 3-[[2-(1-ethylindol-3-yl)acetyl]amino]-2-methyl-3-phenylpropanoic acid.
| Compound Name | 3-[[2-(1-ethylindol-3-yl)acetyl]amino]-2-methyl-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 119218961 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 3-[[2-(1-ethylindol-3-yl)acetyl]amino]-2-methyl-3-phenylpropanoic acid |
| SMILES | CCn1cc(CC(=O)NC(c2ccccc2)C(C)C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C22H24N2O3/c1-3-24-14-17(18-11-7-8-12-19(18)24)13-20(25)23-21(15(2)22(26)27)16-9-5-4-6-10-16/h4-12,14-15,21H,3,13H2,1-2H3,(H,23,25)(H,26,27) |
| InChIKey | HDYNRYQUUIPVGH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |