C18H23NO4 — CID 119219938
6-[(3,4,7-trimethyl-1-benzofuran-2-carbonyl)amino]hexanoic acid (PubChem CID 119219938) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is 6-[(3,4,7-trimethyl-1-benzofuran-2-carbonyl)amino]hexanoic acid.
| Compound Name | 6-[(3,4,7-trimethyl-1-benzofuran-2-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 119219938 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 6-[(3,4,7-trimethyl-1-benzofuran-2-carbonyl)amino]hexanoic acid |
| SMILES | Cc1ccc(C)c2c(C)c(C(=O)NCCCCCC(=O)O)oc12 |
| InChI | InChI=1S/C18H23NO4/c1-11-8-9-12(2)16-15(11)13(3)17(23-16)18(22)19-10-6-4-5-7-14(20)21/h8-9H,4-7,10H2,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | ZFYKRMQVMNSZFC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|