C19H32N2O4 — CID 119220217
6-[[4-(cyclopentanecarbonylamino)cyclohexanecarbonyl]amino]hexanoic acid (PubChem CID 119220217) has the molecular formula C19H32N2O4 and a molecular weight of 352.48 g/mol. Its IUPAC name is 6-[[4-(cyclopentanecarbonylamino)cyclohexanecarbonyl]amino]hexanoic acid.
| Compound Name | 6-[[4-(cyclopentanecarbonylamino)cyclohexanecarbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 119220217 |
| Molecular Formula | C19H32N2O4 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 6-[[4-(cyclopentanecarbonylamino)cyclohexanecarbonyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)C1CCC(NC(=O)C2CCCC2)CC1 |
| InChI | InChI=1S/C19H32N2O4/c22-17(23)8-2-1-5-13-20-18(24)15-9-11-16(12-10-15)21-19(25)14-6-3-4-7-14/h14-16H,1-13H2,(H,20,24)(H,21,25)(H,22,23) |
| InChIKey | VKMAEFQRIIBMRU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|