C19H26N2O4 — CID 119220363
2-[[4-(3-cyclohexylbutanoylamino)benzoyl]amino]acetic acid (PubChem CID 119220363) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-[[4-(3-cyclohexylbutanoylamino)benzoyl]amino]acetic acid.
| Compound Name | 2-[[4-(3-cyclohexylbutanoylamino)benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 119220363 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 2-[[4-(3-cyclohexylbutanoylamino)benzoyl]amino]acetic acid |
| SMILES | CC(CC(=O)Nc1ccc(C(=O)NCC(=O)O)cc1)C1CCCCC1 |
| InChI | InChI=1S/C19H26N2O4/c1-13(14-5-3-2-4-6-14)11-17(22)21-16-9-7-15(8-10-16)19(25)20-12-18(23)24/h7-10,13-14H,2-6,11-12H2,1H3,(H,20,25)(H,21,22)(H,23,24) |
| InChIKey | JASOVAHNOXPMAR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |